3-Ethoxy-4-methoxybenzoic acid
cas: 2651-55-0 — see every product listed under this CAS number, including other names
3-Ethoxy-4-methoxybenzoic acid (CAS 2651-55-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 25g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | CAA65155-5g |
| cas | 2651-55-0 |
| size | 5g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Biosynth | 5g | price on request | |
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 1528.65 Pln | |
| Fluorochem | 25g | 3600.83 Pln |
properties
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
3-ethoxy-4-methoxybenzoic acid (CAS 2651-55-0) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: 3-ethoxy-4-methoxybenzoic acid. InChIKey: DMSAIFTWQMXOBE-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 3-ethoxy-4-methoxybenzoic acid |
| InChIKey | DMSAIFTWQMXOBE-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(=O)O)OC |
Computed by PubChem (NCBI)