cas: 3119-93-5 — see every product listed under this CAS number, including other names
3-Ethyl-2-methylbenzo[d]thiazol-3-ium iodide 98% (CAS 3119-93-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A292640-1g |
| cas | 3119-93-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 976.69 Pln | |
| Ambeed | 100g | 3607.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A292640 |
3-ethyl-2-methyl-1,3-benzothiazol-3-ium iodide (CAS 3119-93-5) is a chemical compound with the molecular formula C10H12INS and a molecular weight of 305.18 g/mol. IUPAC name: 3-ethyl-2-methyl-1,3-benzothiazol-3-ium iodide. InChIKey: HWFCSPDBFXYFKY-UHFFFAOYSA-M.
| Molecular formula | C10H12INS |
|---|---|
| Molecular weight | 305.18 g/mol |
| IUPAC name | 3-ethyl-2-methyl-1,3-benzothiazol-3-ium iodide |
| InChIKey | HWFCSPDBFXYFKY-UHFFFAOYSA-M |
| SMILES | CC[N+]1=C(SC2=CC=CC=C21)C.[I-] |
Computed by PubChem (NCBI)