CAS 622842-91-5 is the registry number for 3-Ethynyl-9H-carbazole, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 1g, 5g.
3-ethynyl-9H-carbazole (CAS 622842-91-5) is a chemical compound with the molecular formula C14H9N and a molecular weight of 191.23 g/mol. IUPAC name: 3-ethynyl-9H-carbazole. InChIKey: OUVRFFPPSIQYMY-UHFFFAOYSA-N.
| Molecular formula | C14H9N |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 3-ethynyl-9H-carbazole |
| InChIKey | OUVRFFPPSIQYMY-UHFFFAOYSA-N |
| SMILES | C#CC1=CC2=C(C=C1)NC3=CC=CC=C32 |
Computed by PubChem (NCBI)