CAS 203-65-6 appears in our catalog under these names: 4,5-Iminophenanthrene, 4H-Benzo(def)carbazole, 95+%. Offered by: TRC, AmBeed. Available pack sizes: 50mg, 25mg.
15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaene (CAS 203-65-6) is a chemical compound with the molecular formula C14H9N and a molecular weight of 191.23 g/mol. IUPAC name: 15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaene. InChIKey: VQOUCGZKKPJLGH-UHFFFAOYSA-N.
| Molecular formula | C14H9N |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaene |
| InChIKey | VQOUCGZKKPJLGH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)NC4=CC=CC(=C43)C=C2 |
Computed by PubChem (NCBI)