Products 622842-91-5

CAS 622842-91-5 is the registry number for 3-Ethynyl-9H-carbazole 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

3-ethynyl-9H-carbazole (CAS 622842-91-5) is a chemical compound with the molecular formula C14H9N and a molecular weight of 191.23 g/mol. IUPAC name: 3-ethynyl-9H-carbazole. InChIKey: OUVRFFPPSIQYMY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9N
Molecular weight191.23 g/mol
IUPAC name3-ethynyl-9H-carbazole
InChIKeyOUVRFFPPSIQYMY-UHFFFAOYSA-N
SMILESC#CC1=CC2=C(C=C1)NC3=CC=CC=C32

Computed by PubChem (NCBI)