cas: 341-27-5 — see every product listed under this CAS number, including other names
3-Fluoro-2-hydroxybenzoic acid 98% (CAS 341-27-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A282511-1g |
| cas | 341-27-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 398.19 Pln | |
| Ambeed | 25g | 565.06 Pln | |
| Ambeed | 100g | 1799.94 Pln | |
| Ambeed | 500g | 6984.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A282511 |
3-fluoro-2-hydroxybenzoic acid (CAS 341-27-5) is a chemical compound with the molecular formula C7H5FO3 and a molecular weight of 156.11 g/mol. IUPAC name: 3-fluoro-2-hydroxybenzoic acid. InChIKey: GFHCXVJXSLGRJR-UHFFFAOYSA-N.
| Molecular formula | C7H5FO3 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 3-fluoro-2-hydroxybenzoic acid |
| InChIKey | GFHCXVJXSLGRJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)O)C(=O)O |
Computed by PubChem (NCBI)