cas: 177596-38-2 — see every product listed under this CAS number, including other names
3-Fluoro-4-(Trifluoromethoxy)Phenol, 98%, 98% (CAS 177596-38-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1136EN-250mg |
| cas | 177596-38-2 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 25g | 1168.40 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 10g | 549.20 Pln | |
| Chemat | 100g | 4038.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-fluoro-4-(trifluoromethoxy)phenol (CAS 177596-38-2) is a chemical compound with the molecular formula C7H4F4O2 and a molecular weight of 196.10 g/mol. IUPAC name: 3-fluoro-4-(trifluoromethoxy)phenol. InChIKey: UTFSPWRTXCDUIJ-UHFFFAOYSA-N.
| Molecular formula | C7H4F4O2 |
|---|---|
| Molecular weight | 196.10 g/mol |
| IUPAC name | 3-fluoro-4-(trifluoromethoxy)phenol |
| InChIKey | UTFSPWRTXCDUIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)F)OC(F)(F)F |
Computed by PubChem (NCBI)