cas: 21667-61-8 — see every product listed under this CAS number, including other names
3-Fluorobenzoylacetonitrile, 97% (CAS 21667-61-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F022382-1G |
| cas | 21667-61-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 2.5g | 518.59 Pln | |
| Fluorochem | 5g | 846.59 Pln | |
| Fluorochem | 10g | 1372.45 Pln | |
| Fluorochem | 25g | 3345.71 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(3-fluorophenyl)-3-oxopropanenitrile (CAS 21667-61-8) is a chemical compound with the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. IUPAC name: 3-(3-fluorophenyl)-3-oxopropanenitrile. InChIKey: UNGFCWRGMBVFAS-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 3-(3-fluorophenyl)-3-oxopropanenitrile |
| InChIKey | UNGFCWRGMBVFAS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=O)CC#N |
Computed by PubChem (NCBI)