CAS 135838-04-9 appears in our catalog under these names: 6-Fluoroquinolin-8-ol, 95%, 6-Fluoroquinolin-8-ol 98%, 6-Fluoroquinolin-8-ol, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
6-fluoroquinolin-8-ol (CAS 135838-04-9) is a chemical compound with the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. IUPAC name: 6-fluoroquinolin-8-ol. InChIKey: SCUWALYGODIPCH-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 6-fluoroquinolin-8-ol |
| InChIKey | SCUWALYGODIPCH-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)O)F |
Computed by PubChem (NCBI)