CAS 142363-59-5 appears in our catalog under these names: 3-Fluoroquinolin-8-ol, 95%, 3–Fluoroquinolin–8–ol, 3-Fluoroquinolin-8-ol 98%, 3-fluoroquinolin-8-ol, 98%, 98%, 3-FLUOROQUINOLIN-8-OL, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
3-fluoroquinolin-8-ol (CAS 142363-59-5) is a chemical compound with the molecular formula C9H6FNO and a molecular weight of 163.15 g/mol. IUPAC name: 3-fluoroquinolin-8-ol. InChIKey: YPZUUMHSIYTYEF-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO |
|---|---|
| Molecular weight | 163.15 g/mol |
| IUPAC name | 3-fluoroquinolin-8-ol |
| InChIKey | YPZUUMHSIYTYEF-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)O)F |
Computed by PubChem (NCBI)