3-Formyl-5-(trifluoromethyl)phenol, 97%, 97%
cas: 1243312-51-7 — see every product listed under this CAS number, including other names
3-Formyl-5-(trifluoromethyl)phenol, 97%, 97% (CAS 1243312-51-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110Y4H-100mg |
| cas | 1243312-51-7 |
| size | 100mg |
| availability | 25g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 597.20 Pln | |
| Chemat | 500mg | 952.40 Pln | |
| Chemat | 1g | 1379.60 Pln | |
| Chemat | 5g | 4158.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-hydroxy-5-(trifluoromethyl)benzaldehyde (CAS 1243312-51-7) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: 3-hydroxy-5-(trifluoromethyl)benzaldehyde. InChIKey: NEQXALZOVLWZSE-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 3-hydroxy-5-(trifluoromethyl)benzaldehyde |
| InChIKey | NEQXALZOVLWZSE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)O)C=O |
Computed by PubChem (NCBI)