CAS 75650-38-3 appears in our catalog under these names: 3-Formylbenzoyl chloride, 95%, 3-Formylbenzoyl chloride, ≥95%, Benzoyl chloride, 3-formyl- (9CI), ≥95%, ≥95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 250mg, 1g.
3-formylbenzoyl chloride (CAS 75650-38-3) is a chemical compound with the molecular formula C8H5ClO2 and a molecular weight of 168.57 g/mol. IUPAC name: 3-formylbenzoyl chloride. InChIKey: LNRRJKXBZVUZHJ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO2 |
|---|---|
| Molecular weight | 168.57 g/mol |
| IUPAC name | 3-formylbenzoyl chloride |
| InChIKey | LNRRJKXBZVUZHJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)Cl)C=O |
Computed by PubChem (NCBI)