CAS 117886-88-1 appears in our catalog under these names: 2-Formylbenzoyl chloride, 95%, 2-Formylbenzoyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.
2-formylbenzoyl chloride (CAS 117886-88-1) is a chemical compound with the molecular formula C8H5ClO2 and a molecular weight of 168.57 g/mol. IUPAC name: 2-formylbenzoyl chloride. InChIKey: QPOPOGXCFMHHLZ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO2 |
|---|---|
| Molecular weight | 168.57 g/mol |
| IUPAC name | 2-formylbenzoyl chloride |
| InChIKey | QPOPOGXCFMHHLZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C(=O)Cl |
Computed by PubChem (NCBI)