Products 117886-88-1

CAS 117886-88-1 appears in our catalog under these names: 2-Formylbenzoyl chloride, 95%, 2-Formylbenzoyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.

2-formylbenzoyl chloride (CAS 117886-88-1) is a chemical compound with the molecular formula C8H5ClO2 and a molecular weight of 168.57 g/mol. IUPAC name: 2-formylbenzoyl chloride. InChIKey: QPOPOGXCFMHHLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClO2
Molecular weight168.57 g/mol
IUPAC name2-formylbenzoyl chloride
InChIKeyQPOPOGXCFMHHLZ-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C=O)C(=O)Cl

Computed by PubChem (NCBI)