CAS 70097-45-9 appears in our catalog under these names: 7-Chlorophthalide, 98%, 7–Chlorophthalide, 7-Chloroisobenzofuran-1(3H)-one 98%, 7-Chlorophthalide, 98%, 98%, 7-Chloroisobenzofuran-1(3H)-one, >=98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
7-chloro-3H-2-benzofuran-1-one (CAS 70097-45-9) is a chemical compound with the molecular formula C8H5ClO2 and a molecular weight of 168.57 g/mol. IUPAC name: 7-chloro-3H-2-benzofuran-1-one. InChIKey: LLKCTHJTJUDDMG-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO2 |
|---|---|
| Molecular weight | 168.57 g/mol |
| IUPAC name | 7-chloro-3H-2-benzofuran-1-one |
| InChIKey | LLKCTHJTJUDDMG-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)Cl)C(=O)O1 |
Computed by PubChem (NCBI)