3-IODO-4-NITRO-1H-INDAZOLE, 95%
cas: 885521-22-2 — see every product listed under this CAS number, including other names
3-IODO-4-NITRO-1H-INDAZOLE, 95% (CAS 885521-22-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F794458-100MG |
| cas | 885521-22-2 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1476.58 Pln | |
| Fluorochem | 10g | 2715.73 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1004.50 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 798.80 Pln | |
| Chemat | 10g | 1538.00 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
3-iodo-4-nitro-2H-indazole (CAS 885521-22-2) is a chemical compound with the molecular formula C7H4IN3O2 and a molecular weight of 289.03 g/mol. IUPAC name: 3-iodo-4-nitro-2H-indazole. InChIKey: AOTAXYVEONHYHY-UHFFFAOYSA-N.
| Molecular formula | C7H4IN3O2 |
|---|---|
| Molecular weight | 289.03 g/mol |
| IUPAC name | 3-iodo-4-nitro-2H-indazole |
| InChIKey | AOTAXYVEONHYHY-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2C(=C1)[N+](=O)[O-])I |
Computed by PubChem (NCBI)