CAS 160732-56-9 appears in our catalog under these names: 1-Azido-1,2-benziodoxol-3(1h)-one, 95%, 1-AZIDO-1,2-BENZIODOXOL-3(1H)-ONE, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g.
1-azido-1lambda3,2-benziodoxol-3-one (CAS 160732-56-9) is a chemical compound with the molecular formula C7H4IN3O2 and a molecular weight of 289.03 g/mol. IUPAC name: 1-azido-1lambda3,2-benziodoxol-3-one. InChIKey: XRUIUFFBFTVHKT-UHFFFAOYSA-N.
| Molecular formula | C7H4IN3O2 |
|---|---|
| Molecular weight | 289.03 g/mol |
| IUPAC name | 1-azido-1lambda3,2-benziodoxol-3-one |
| InChIKey | XRUIUFFBFTVHKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OI2N=[N+]=[N-] |
Computed by PubChem (NCBI)