CAS 1638766-94-5 is the registry number for 5-Iodo-7h-pyrrolo[2,3-d]pyrimidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
5-iodo-7H-pyrrolo[2,3-d]pyrimidine-2-carboxylic acid (CAS 1638766-94-5) is a chemical compound with the molecular formula C7H4IN3O2 and a molecular weight of 289.03 g/mol. IUPAC name: 5-iodo-7H-pyrrolo[2,3-d]pyrimidine-2-carboxylic acid. InChIKey: NEBKEHIDEKDSOG-UHFFFAOYSA-N.
| Molecular formula | C7H4IN3O2 |
|---|---|
| Molecular weight | 289.03 g/mol |
| IUPAC name | 5-iodo-7H-pyrrolo[2,3-d]pyrimidine-2-carboxylic acid |
| InChIKey | NEBKEHIDEKDSOG-UHFFFAOYSA-N |
| SMILES | C1=C(C2=CN=C(N=C2N1)C(=O)O)I |
Computed by PubChem (NCBI)