cas: 60772-67-0 — see every product listed under this CAS number, including other names
3-ISOPROPOXYBENZOIC ACID, 97%, 97% (CAS 60772-67-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EA90-100mg |
| cas | 60772-67-0 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 827.60 Pln | |
| Chemat | 10g | 1437.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-propan-2-yloxybenzoic acid (CAS 60772-67-0) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 3-propan-2-yloxybenzoic acid. InChIKey: QPVBLLQBUNVSJT-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 3-propan-2-yloxybenzoic acid |
| InChIKey | QPVBLLQBUNVSJT-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)