Products 60772-67-0
CAS 60772-67-0 appears in our catalog under these names: 3-Isopropoxybenzoic acid, 95%, 3-Isopropoxybenzoic Acid, >95% (HPLC), 3-ISOPROPOXYBENZOIC ACID, 97%, 97%, 3-Isopropoxybenzoic acid, 97%, 3-iso-Propoxybenzoic acid, 95%. Offered by: Combi-blocks, TRC, Chemat, Ambeed, BLDpharm. Available pack sizes: 10g, 5g, 25g, 1g, 100mg, 500mg, 250mg.
3-propan-2-yloxybenzoic acid (CAS 60772-67-0) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 3-propan-2-yloxybenzoic acid. InChIKey: QPVBLLQBUNVSJT-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 3-propan-2-yloxybenzoic acid |
| InChIKey | QPVBLLQBUNVSJT-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)