cas: 60772-67-0 — see every product listed under this CAS number, including other names
3-Isopropoxybenzoic acid 97% (CAS 60772-67-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A739799-1g |
| cas | 60772-67-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 670.75 Pln | |
| Ambeed | 10g | 987.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A739799 |
3-propan-2-yloxybenzoic acid (CAS 60772-67-0) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 3-propan-2-yloxybenzoic acid. InChIKey: QPVBLLQBUNVSJT-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 3-propan-2-yloxybenzoic acid |
| InChIKey | QPVBLLQBUNVSJT-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)