cas: 408492-28-4 — see every product listed under this CAS number, including other names
3-Iodo-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene, 97% (CAS 408492-28-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037437-1G |
| cas | 408492-28-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 450.90 Pln | |
| Fluorochem | 25g | 1632.78 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 408492-28-4) is a chemical compound with the molecular formula C12H16BIO2 and a molecular weight of 329.97 g/mol. IUPAC name: 2-(3-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HSHFNMSHDHAHDN-UHFFFAOYSA-N.
| Molecular formula | C12H16BIO2 |
|---|---|
| Molecular weight | 329.97 g/mol |
| IUPAC name | 2-(3-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HSHFNMSHDHAHDN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)I |
Computed by PubChem (NCBI)