CAS 73852-88-7 appears in our catalog under these names: 2-(4-Iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 4-IODOPHENYLBORONIC ACID PINACOL ESTER,&, 2-(4-Iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 2-(4-Iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 100g, 250mg, 1g, 5g, 25g, 50mg, 10g, 50g.
2-(4-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 73852-88-7) is a chemical compound with the molecular formula C12H16BIO2 and a molecular weight of 329.97 g/mol. IUPAC name: 2-(4-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ACCWXFPZHMACEN-UHFFFAOYSA-N.
| Molecular formula | C12H16BIO2 |
|---|---|
| Molecular weight | 329.97 g/mol |
| IUPAC name | 2-(4-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ACCWXFPZHMACEN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)I |
Computed by PubChem (NCBI)