CAS 408492-28-4 appears in our catalog under these names: 3-Iodophenylboronic acid, pinacol ester, 96%, 3–Iodophenylboronic acid pinacol ester, 3-Iodobenzeneboronic acid pinacol ester, 97% , 2-(3-Iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 2-(3-Iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 250mg, 100mg.
2-(3-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 408492-28-4) is a chemical compound with the molecular formula C12H16BIO2 and a molecular weight of 329.97 g/mol. IUPAC name: 2-(3-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HSHFNMSHDHAHDN-UHFFFAOYSA-N.
| Molecular formula | C12H16BIO2 |
|---|---|
| Molecular weight | 329.97 g/mol |
| IUPAC name | 2-(3-iodophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HSHFNMSHDHAHDN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)I |
Computed by PubChem (NCBI)