cas: 151899-62-6 — see every product listed under this CAS number, including other names
3-Iodo-1-trityl-1H-1,2,4-triazole, 97% (CAS 151899-62-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F791704-100MG |
| cas | 151899-62-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 981.96 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-iodo-1-trityl-1,2,4-triazole (CAS 151899-62-6) is a chemical compound with the molecular formula C21H16IN3 and a molecular weight of 437.3 g/mol. IUPAC name: 3-iodo-1-trityl-1,2,4-triazole. InChIKey: QHQHALMULRXBKM-UHFFFAOYSA-N.
| Molecular formula | C21H16IN3 |
|---|---|
| Molecular weight | 437.3 g/mol |
| IUPAC name | 3-iodo-1-trityl-1,2,4-triazole |
| InChIKey | QHQHALMULRXBKM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=NC(=N4)I |
Computed by PubChem (NCBI)