CAS 151899-62-6 appears in our catalog under these names: 3-Iodo-1-trityl-1h-1,2,4-triazole, 95%, 3–Iodo–1–trityl–1H–1,2,4–triazole, 3-Iodo-1-trityl-1H-1,2,4-triazole, 98%, 98%, 3-Iodo-1-trityl-1H-1,2,4-triazole, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
3-iodo-1-trityl-1,2,4-triazole (CAS 151899-62-6) is a chemical compound with the molecular formula C21H16IN3 and a molecular weight of 437.3 g/mol. IUPAC name: 3-iodo-1-trityl-1,2,4-triazole. InChIKey: QHQHALMULRXBKM-UHFFFAOYSA-N.
| Molecular formula | C21H16IN3 |
|---|---|
| Molecular weight | 437.3 g/mol |
| IUPAC name | 3-iodo-1-trityl-1,2,4-triazole |
| InChIKey | QHQHALMULRXBKM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=NC(=N4)I |
Computed by PubChem (NCBI)