CAS 151899-61-5 is the registry number for 5-Iodo-1-(triphenylmethyl)-1h-1,2,4-triazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-iodo-1-trityl-1,2,4-triazole (CAS 151899-61-5) is a chemical compound with the molecular formula C21H16IN3 and a molecular weight of 437.3 g/mol. IUPAC name: 5-iodo-1-trityl-1,2,4-triazole. InChIKey: QNCJCRXIYSCNSK-UHFFFAOYSA-N.
| Molecular formula | C21H16IN3 |
|---|---|
| Molecular weight | 437.3 g/mol |
| IUPAC name | 5-iodo-1-trityl-1,2,4-triazole |
| InChIKey | QNCJCRXIYSCNSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C(=NC=N4)I |
Computed by PubChem (NCBI)