3-Iodo-5-nitro-1H-indazole, 97%
cas: 70315-69-4 — see every product listed under this CAS number, including other names
3-Iodo-5-nitro-1H-indazole, 97% (CAS 70315-69-4) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F067577-100G |
| cas | 70315-69-4 |
| size | 100g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 3272.82 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 376.40 Pln | |
| Chemat | 10g | 630.80 Pln | |
| Chemat | 25g | 1326.80 Pln | |
| Chemat | 50g | 2584.40 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 25g | 919.49 Pln | |
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 679.99 Pln | |
| Fluorochem | 25g | 2481.44 Pln | |
| Fluorochem | 10g | 1164.19 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
3-iodo-5-nitro-2H-indazole (CAS 70315-69-4) is a chemical compound with the molecular formula C7H4IN3O2 and a molecular weight of 289.03 g/mol. IUPAC name: 3-iodo-5-nitro-2H-indazole. InChIKey: UCTRCMYXPOXOSN-UHFFFAOYSA-N.
| Molecular formula | C7H4IN3O2 |
|---|---|
| Molecular weight | 289.03 g/mol |
| IUPAC name | 3-iodo-5-nitro-2H-indazole |
| InChIKey | UCTRCMYXPOXOSN-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2C=C1[N+](=O)[O-])I |
Computed by PubChem (NCBI)