3-Iodo-7-nitro-1H-indazole, 98%
cas: 864724-64-1 — see every product listed under this CAS number, including other names
3-Iodo-7-nitro-1H-indazole, 98% (CAS 864724-64-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 25g, 50g, 100g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F336577-1G |
| cas | 864724-64-1 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 211.40 Pln | |
| Fluorochem | 5g | 586.27 Pln | |
| Fluorochem | 10g | 955.93 Pln | |
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 700.81 Pln | |
| Fluorochem | 10g | 1138.16 Pln | |
| Fluorochem | 25g | 2642.84 Pln | |
| Fluorochem | 50g | 4699.40 Pln | |
| Fluorochem | 100g | 8010.74 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 429.20 Pln | |
| Chemat | 10g | 683.60 Pln | |
| Chemat | 25g | 1576.40 Pln | |
| Chemat | 50g | 2819.60 Pln | |
| Chemat | 100g | 4888.40 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
3-iodo-7-nitro-2H-indazole (CAS 864724-64-1) is a chemical compound with the molecular formula C7H4IN3O2 and a molecular weight of 289.03 g/mol. IUPAC name: 3-iodo-7-nitro-2H-indazole. InChIKey: CVQKINXVUVZMJY-UHFFFAOYSA-N.
| Molecular formula | C7H4IN3O2 |
|---|---|
| Molecular weight | 289.03 g/mol |
| IUPAC name | 3-iodo-7-nitro-2H-indazole |
| InChIKey | CVQKINXVUVZMJY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C(=C1)[N+](=O)[O-])I |
Computed by PubChem (NCBI)