cas: 20442-79-9 — see every product listed under this CAS number, including other names
3-Iodobiphenyl, >98.0%(GC) (CAS 20442-79-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | I1055-1G |
| cas | 20442-79-9 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 236.36 Pln | |
| TCI | 5g | 708.42 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-iodo-3-phenylbenzene (CAS 20442-79-9) is a chemical compound with the molecular formula C12H9I and a molecular weight of 280.10 g/mol. IUPAC name: 1-iodo-3-phenylbenzene. InChIKey: KAQUBIATNWQNRE-UHFFFAOYSA-N.
| Molecular formula | C12H9I |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 1-iodo-3-phenylbenzene |
| InChIKey | KAQUBIATNWQNRE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)I |
Computed by PubChem (NCBI)