3-Iodobiphenyl, 98%
cas: 20442-79-9 — see every product listed under this CAS number, including other names
3-Iodobiphenyl, 98% (CAS 20442-79-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F303195-1G |
| cas | 20442-79-9 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 190.58 Pln | |
| Fluorochem | 10g | 320.74 Pln | |
| Fluorochem | 25g | 450.90 Pln | |
| Fluorochem | 100g | 1268.32 Pln | |
| Fluorochem | 500g | 4314.12 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-iodo-3-phenylbenzene (CAS 20442-79-9) is a chemical compound with the molecular formula C12H9I and a molecular weight of 280.10 g/mol. IUPAC name: 1-iodo-3-phenylbenzene. InChIKey: KAQUBIATNWQNRE-UHFFFAOYSA-N.
| Molecular formula | C12H9I |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 1-iodo-3-phenylbenzene |
| InChIKey | KAQUBIATNWQNRE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)I |
Computed by PubChem (NCBI)