CAS 20442-79-9 appears in our catalog under these names: 3-Iodo-biphenyl, 96%, 3–Iodo–biphenyl, 3-Iodobiphenyl, >98.0%(GC), 3-Iodobiphenyl, 98%, 98%, 3-Iodobiphenyl, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g, 10g, 15g, 500g, 1kg.
1-iodo-3-phenylbenzene (CAS 20442-79-9) is a chemical compound with the molecular formula C12H9I and a molecular weight of 280.10 g/mol. IUPAC name: 1-iodo-3-phenylbenzene. InChIKey: KAQUBIATNWQNRE-UHFFFAOYSA-N.
| Molecular formula | C12H9I |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 1-iodo-3-phenylbenzene |
| InChIKey | KAQUBIATNWQNRE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)I |
Computed by PubChem (NCBI)