3-Isopropylphenylboronic acid, 96%
cas: 216019-28-2 — see every product listed under this CAS number, including other names
3-Isopropylphenylboronic acid, 96% (CAS 216019-28-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A102346-250mg |
| cas | 216019-28-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 10g | 464.94 Pln | |
| Ambeed | 25g | 782.00 Pln | |
| Ambeed | 100g | 2295.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 10g | 270.80 Pln | |
| Chemat | 25g | 506.00 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 297.70 Pln | |
| BLDpharm | 10g | 497.63 Pln | |
| BLDpharm | 25g | 841.95 Pln | |
| BLDpharm | 100g | 2469.16 Pln | |
| Fluorochem | 1g | 117.68 Pln | |
| Fluorochem | 5g | 263.47 Pln | |
| Fluorochem | 10g | 445.69 Pln | |
| Fluorochem | 25g | 804.94 Pln | |
| Fluorochem | 100g | 2356.48 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
(3-propan-2-ylphenyl)boronic acid (CAS 216019-28-2) is a chemical compound with the molecular formula C9H13BO2 and a molecular weight of 164.01 g/mol. IUPAC name: (3-propan-2-ylphenyl)boronic acid. InChIKey: QSWLFBMVIGQONC-UHFFFAOYSA-N.
| Molecular formula | C9H13BO2 |
|---|---|
| Molecular weight | 164.01 g/mol |
| IUPAC name | (3-propan-2-ylphenyl)boronic acid |
| InChIKey | QSWLFBMVIGQONC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Isopropylbenzeneboronic acid, 3-Isopropylphenylboronic acid, (3-isopropylphenyl)boronic acid, (3-propan-2-ylphenyl)boronic Acid, 3-Isoprophenylboronic acid, 3-Isopropylphenylboronic Acid (contains varying amounts of Anhydride), 3isopropylphenylboronic acid, 3-Isopropylphenbylboronic acid, 3-isopropyl-phenylboronic acid, 3-isopropylphenyl boronic acid