Products 2241870-50-6
CAS 2241870-50-6 is the registry number for (3，4，5–tris(methyl–d3)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[3,4,5-tris(trideuteriomethyl)phenyl]boronic acid (CAS 2241870-50-6) is a chemical compound with the molecular formula C9H13BO2 and a molecular weight of 173.07 g/mol. IUPAC name: [3,4,5-tris(trideuteriomethyl)phenyl]boronic acid. InChIKey: NKBVADXTZTWXMA-GQALSZNTSA-N.
| Molecular formula | C9H13BO2 |
|---|---|
| Molecular weight | 173.07 g/mol |
| IUPAC name | [3,4,5-tris(trideuteriomethyl)phenyl]boronic acid |
| InChIKey | NKBVADXTZTWXMA-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=CC(=C1C([2H])([2H])[2H])C([2H])([2H])[2H])B(O)O |
Computed by PubChem (NCBI)