Products 216019-28-2
CAS 216019-28-2 appears in our catalog under these names: 3–Isopropylphenylboronic Acid (contains varying amounts of Anhydride), 3-Isopropylbenzeneboronic acid, 99% , 3-Isopropylphenylboronic Acid (contains varying amounts of Anhydride), 3-Isopropylphenylboronic acid 96%, 3-Isopropylphenylboronic acid, 96%, 96%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 100g.
(3-propan-2-ylphenyl)boronic acid (CAS 216019-28-2) is a chemical compound with the molecular formula C9H13BO2 and a molecular weight of 164.01 g/mol. IUPAC name: (3-propan-2-ylphenyl)boronic acid. InChIKey: QSWLFBMVIGQONC-UHFFFAOYSA-N.
| Molecular formula | C9H13BO2 |
|---|---|
| Molecular weight | 164.01 g/mol |
| IUPAC name | (3-propan-2-ylphenyl)boronic acid |
| InChIKey | QSWLFBMVIGQONC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Isopropylbenzeneboronic acid, 3-Isopropylphenylboronic acid, (3-isopropylphenyl)boronic acid, (3-propan-2-ylphenyl)boronic Acid, 3-Isoprophenylboronic acid, 3-Isopropylphenylboronic Acid (contains varying amounts of Anhydride), 3isopropylphenylboronic acid, 3-Isopropylphenbylboronic acid, 3-isopropyl-phenylboronic acid, 3-isopropylphenyl boronic acid