cas: 325142-89-0 — see every product listed under this CAS number, including other names
3-Isopropylphenylboronic acid, pinacol ester, 97%, 97% (CAS 325142-89-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ETY-250mg |
| cas | 325142-89-0 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 525.20 Pln | |
| Chemat | 25g | 2378.00 Pln | |
| Chemat | 100mg | 98.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(3-propan-2-ylphenyl)-1,3,2-dioxaborolane (CAS 325142-89-0) is a chemical compound with the molecular formula C15H23BO2 and a molecular weight of 246.15 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-propan-2-ylphenyl)-1,3,2-dioxaborolane. InChIKey: ORRCXIHAXGJPNU-UHFFFAOYSA-N.
| Molecular formula | C15H23BO2 |
|---|---|
| Molecular weight | 246.15 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-propan-2-ylphenyl)-1,3,2-dioxaborolane |
| InChIKey | ORRCXIHAXGJPNU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(C)C |
Computed by PubChem (NCBI)