cas: 19355-04-5 — see every product listed under this CAS number, including other names
3-Methoxy-4-nitropyridine 1-oxide, 97%, 97% (CAS 19355-04-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AKIK-100mg |
| cas | 19355-04-5 |
| size | 100mg |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 500mg | 357.20 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 2118.80 Pln | |
| Chemat | 10g | 3501.20 Pln | |
| Chemat | 25g | 6938.00 Pln | |
| Chemat | 100g | 17939.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-methoxy-4-nitro-1-oxidopyridin-1-ium (CAS 19355-04-5) is a chemical compound with the molecular formula C6H6N2O4 and a molecular weight of 170.12 g/mol. IUPAC name: 3-methoxy-4-nitro-1-oxidopyridin-1-ium. InChIKey: YTTSNODVMTUELN-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4 |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | 3-methoxy-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | YTTSNODVMTUELN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C[N+](=C1)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)