cas: 936728-20-0 — see every product listed under this CAS number, including other names
3-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid 98% (CAS 936728-20-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A658550-100mg |
| cas | 936728-20-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 426.00 Pln | |
| Ambeed | 250mg | 498.31 Pln | |
| Ambeed | 1g | 960.00 Pln | |
| Ambeed | 5g | 3296.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A658550 |
3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 936728-20-0) is a chemical compound with the molecular formula C14H19BO5 and a molecular weight of 278.11 g/mol. IUPAC name: 3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: ZEDIRMKDJWTATP-UHFFFAOYSA-N.
| Molecular formula | C14H19BO5 |
|---|---|
| Molecular weight | 278.11 g/mol |
| IUPAC name | 3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | ZEDIRMKDJWTATP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OC)C(=O)O |
Computed by PubChem (NCBI)