cas: 75710-99-5 — see every product listed under this CAS number, including other names
3-Methoxy-5-nitropyridin-2-ol, 98% (CAS 75710-99-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 250mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A426088-25g |
| cas | 75710-99-5 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 11495.05 Pln | |
| AmBeed | 5g | 3754.66 Pln | |
| AmBeed | 250mg | 1046.50 Pln | |
| AmBeed | 10g | 6417.25 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-methoxy-5-nitro-1H-pyridin-2-one (CAS 75710-99-5) is a chemical compound with the molecular formula C6H6N2O4 and a molecular weight of 170.12 g/mol. IUPAC name: 3-methoxy-5-nitro-1H-pyridin-2-one. InChIKey: JDHPYWKDVDFUDW-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4 |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | 3-methoxy-5-nitro-1H-pyridin-2-one |
| InChIKey | JDHPYWKDVDFUDW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CNC1=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)