cas: 882670-26-0 — see every product listed under this CAS number, including other names
3-Methoxybenzene-1-sulfonyl fluoride 95% (CAS 882670-26-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1127152-250mg |
| cas | 882670-26-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 871.00 Pln | |
| Ambeed | 5g | 3346.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1127152 |
3-methoxybenzenesulfonyl fluoride (CAS 882670-26-0) is a chemical compound with the molecular formula C7H7FO3S and a molecular weight of 190.19 g/mol. IUPAC name: 3-methoxybenzenesulfonyl fluoride. InChIKey: RGVNAVGZAZZJBS-UHFFFAOYSA-N.
| Molecular formula | C7H7FO3S |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 3-methoxybenzenesulfonyl fluoride |
| InChIKey | RGVNAVGZAZZJBS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC=C1)S(=O)(=O)F |
Computed by PubChem (NCBI)