CAS 368-91-2 appears in our catalog under these names: 4-methoxybenzenesulfonyl fluoride, 95%, 4-METHOXYBENZENESULFONYL FLUORIDE, 4-Methoxy-benzenesulfonyl fluoride, 99%(GC-MS),RG, 99%(GC-MS),RG, 4-Methoxybenzenesulfonyl fluoride, 99%. Offered by: Combi-blocks, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 100mg, 250mg.
4-methoxybenzenesulfonyl fluoride (CAS 368-91-2) is a chemical compound with the molecular formula C7H7FO3S and a molecular weight of 190.19 g/mol. IUPAC name: 4-methoxybenzenesulfonyl fluoride. InChIKey: QHEMDSDRFAIOOU-UHFFFAOYSA-N.
| Molecular formula | C7H7FO3S |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 4-methoxybenzenesulfonyl fluoride |
| InChIKey | QHEMDSDRFAIOOU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)F |
Computed by PubChem (NCBI)