CAS 72358-72-6 is the registry number for 4-Fluorophenyl methanesulfonate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(4-fluorophenyl) methanesulfonate (CAS 72358-72-6) is a chemical compound with the molecular formula C7H7FO3S and a molecular weight of 190.19 g/mol. IUPAC name: (4-fluorophenyl) methanesulfonate. InChIKey: KERGNBBIBYFCRB-UHFFFAOYSA-N.
| Molecular formula | C7H7FO3S |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | (4-fluorophenyl) methanesulfonate |
| InChIKey | KERGNBBIBYFCRB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1=CC=C(C=C1)F |
Computed by PubChem (NCBI)