cas: 69240-50-2 — see every product listed under this CAS number, including other names
3-Methyl-[1,1'-biphenyl]-4-carboxylic acid, ≥99.3%, ≥99.3% (CAS 69240-50-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G1X9-1g |
| cas | 69240-50-2 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2373.20 Pln |
| purity | ≥99.3% |
|---|---|
| delivery time | 3 weeks |
2-methyl-4-phenylbenzoic acid (CAS 69240-50-2) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 2-methyl-4-phenylbenzoic acid. InChIKey: CAHIDRFUQUEUTR-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 2-methyl-4-phenylbenzoic acid |
| InChIKey | CAHIDRFUQUEUTR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)