CAS 1547645-53-3 is the registry number for 3-Methyl-1H-pyrazolo[3,4-b]pyridine-6-carboxylic acid, 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
3-methyl-2H-pyrazolo[3,4-b]pyridine-6-carboxylic acid (CAS 1547645-53-3) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 3-methyl-2H-pyrazolo[3,4-b]pyridine-6-carboxylic acid. InChIKey: LNJGBGIQGIPPJS-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 3-methyl-2H-pyrazolo[3,4-b]pyridine-6-carboxylic acid |
| InChIKey | LNJGBGIQGIPPJS-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=NC2=NN1)C(=O)O |
Computed by PubChem (NCBI)