CAS 67074-71-9 appears in our catalog under these names: 1-Methylpyrido[2,3-b]pyrazine-2,3(1h,4h)-dione, 95%, 1–Methylpyrido(2,3–b)pyrazine–2,3(1H,4H)–dione, 1-Methylpyrido(2,3-b)pyrazine-2,3(1H,4H)-dione, 1-Methylpyrido[2,3-b]pyrazine-2,3(1H,4H)-dione 97%, 1-Methylpyrido[2,3-b]pyrazine-2,3(1H,4H)-dione, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
1-methyl-4H-pyrido[2,3-b]pyrazine-2,3-dione (CAS 67074-71-9) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 1-methyl-4H-pyrido[2,3-b]pyrazine-2,3-dione. InChIKey: BSQBDLZRKDSFOK-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 1-methyl-4H-pyrido[2,3-b]pyrazine-2,3-dione |
| InChIKey | BSQBDLZRKDSFOK-UHFFFAOYSA-N |
| SMILES | CN1C2=C(NC(=O)C1=O)N=CC=C2 |
Computed by PubChem (NCBI)