CAS 57155-23-4 is the registry number for 1-Methyl-7-nitro-1,3-benzodiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-methyl-7-nitrobenzimidazole (CAS 57155-23-4) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 1-methyl-7-nitrobenzimidazole. InChIKey: KEABNFLSDJZPEP-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 1-methyl-7-nitrobenzimidazole |
| InChIKey | KEABNFLSDJZPEP-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)