cas: 537705-06-9 — see every product listed under this CAS number, including other names
3-Methyl-4-((6-methylpyridin-3-yl)oxy)aniline, 98% (CAS 537705-06-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A498206-1g |
| cas | 537705-06-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 2869.30 Pln | |
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 601.89 Pln | |
| Fluorochem | 1g | 2090.95 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-methyl-4-[(6-methyl-3-pyridinyl)oxy]aniline (CAS 537705-06-9) is a chemical compound with the molecular formula C13H14N2O and a molecular weight of 214.26 g/mol. IUPAC name: 3-methyl-4-[(6-methyl-3-pyridinyl)oxy]aniline. InChIKey: GBMQBBQKWXOOJZ-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 3-methyl-4-[(6-methyl-3-pyridinyl)oxy]aniline |
| InChIKey | GBMQBBQKWXOOJZ-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)OC2=C(C=C(C=C2)N)C |
Computed by PubChem (NCBI)