CAS 400876-78-0 appears in our catalog under these names: 3,5-Dimethyl-1-(4-methylphenyl)-1h-pyrazole-4-carbaldehyde, 95%, 3,5-Dimethyl-1-(p-tolyl)-1H-pyrazole-4-carbaldehyde, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
3,5-dimethyl-1-(4-methylphenyl)pyrazole-4-carbaldehyde (CAS 400876-78-0) is a chemical compound with the molecular formula C13H14N2O and a molecular weight of 214.26 g/mol. IUPAC name: 3,5-dimethyl-1-(4-methylphenyl)pyrazole-4-carbaldehyde. InChIKey: RUUBYKOMCHAZSW-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 3,5-dimethyl-1-(4-methylphenyl)pyrazole-4-carbaldehyde |
| InChIKey | RUUBYKOMCHAZSW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=C(C(=N2)C)C=O)C |
Computed by PubChem (NCBI)