CAS 400757-04-2 appears in our catalog under these names: 3,5-Dimethyl-1-(2-methylphenyl)-1h-pyrazole-4-carbaldehyde, 95%, 3,5-Dimethyl-1-(o-tolyl)-1H-pyrazole-4-carbaldehyde, 98%, 3,5-Dimethyl-1-o-tolyl-1H-pyrazole-4-carbaldehyde. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg.
3,5-dimethyl-1-(2-methylphenyl)pyrazole-4-carbaldehyde (CAS 400757-04-2) is a chemical compound with the molecular formula C13H14N2O and a molecular weight of 214.26 g/mol. IUPAC name: 3,5-dimethyl-1-(2-methylphenyl)pyrazole-4-carbaldehyde. InChIKey: MXWICIXTAYJZCH-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 3,5-dimethyl-1-(2-methylphenyl)pyrazole-4-carbaldehyde |
| InChIKey | MXWICIXTAYJZCH-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N2C(=C(C(=N2)C)C=O)C |
Computed by PubChem (NCBI)