CAS 5367-32-8 appears in our catalog under these names: 3–Methyl–4–nitroanisole, 3-Methyl-4-nitroanisole, 5-Methoxy-2-nitrotoluene, >98.0%(GC), 3-Methyl-4-nitroanisole, 97%, 97%, 1-Methoxy-3-methyl-4-nitrobenzene, 98%. Offered by: GLPBio, Biosynth, TCI, Chemat, Fluorochem. Available pack sizes: 100g, 500g, 0,1kg, 0,5kg, 25g, 5g, 10g.
4-methoxy-2-methyl-1-nitrobenzene (CAS 5367-32-8) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 4-methoxy-2-methyl-1-nitrobenzene. InChIKey: RTZOGYCMIMOVHU-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 4-methoxy-2-methyl-1-nitrobenzene |
| InChIKey | RTZOGYCMIMOVHU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)