cas: 1111637-91-2 — see every product listed under this CAS number, including other names
3-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine 98% (CAS 1111637-91-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A713214-100mg |
| cas | 1111637-91-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 348.12 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 2244.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A713214 |
3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 1111637-91-2) is a chemical compound with the molecular formula C12H19BN2O2 and a molecular weight of 234.10 g/mol. IUPAC name: 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: BWEOUBYDXFBFMA-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O2 |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | BWEOUBYDXFBFMA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)N)C |
Computed by PubChem (NCBI)